C31H39N7O — CID 155119803
4-[4-[6-[2-[(E)-but-1-enyl]-N-methylanilino]-9-pentylpurin-2-yl]piperazin-1-yl]phenol (PubChem CID 155119803) has the molecular formula C31H39N7O and a molecular weight of 525.70 g/mol. Its IUPAC name is 4-[4-[6-[2-[(E)-but-1-enyl]-N-methylanilino]-9-pentylpurin-2-yl]piperazin-1-yl]phenol.
| Compound Name | 4-[4-[6-[2-[(E)-but-1-enyl]-N-methylanilino]-9-pentylpurin-2-yl]piperazin-1-yl]phenol |
|---|---|
| PubChem CID | 155119803 |
| Molecular Formula | C31H39N7O |
| Molecular Weight | 525.70 g/mol |
| Exact Mass | 525.32 |
| IUPAC Name | 4-[4-[6-[2-[(E)-but-1-enyl]-N-methylanilino]-9-pentylpurin-2-yl]piperazin-1-yl]phenol |
| SMILES | CC/C=C/c1ccccc1N(C)c1nc(N2CCN(c3ccc(O)cc3)CC2)nc2c1ncn2CCCCC |
| InChI | InChI=1S/C31H39N7O/c1-4-6-10-18-38-23-32-28-29(35(3)27-13-9-8-12-24(27)11-7-5-2)33-31(34-30(28)38)37-21-19-36(20-22-37)25-14-16-26(39)17-15-25/h7-9,11-17,23,39H,4-6,10,18-22H2,1-3H3/b11-7+ |
| InChIKey | UJYXPRFBRZIREC-YRNVUSSQSA-N |
| XLogP | 6.24 |
| TPSA | 73.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.70 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|