C30H38N8O2Si — CID 164764185
4-[4-[6-(benzimidazol-1-yl)-9-[2-[tert-butyl(dimethyl)silyl]oxyethyl]purin-2-yl]piperazin-1-yl]phenol (PubChem CID 164764185) has the molecular formula C30H38N8O2Si and a molecular weight of 570.77 g/mol. Its IUPAC name is 4-[4-[6-(benzimidazol-1-yl)-9-[2-[tert-butyl(dimethyl)silyl]oxyethyl]purin-2-yl]piperazin-1-yl]phenol.
| Compound Name | 4-[4-[6-(benzimidazol-1-yl)-9-[2-[tert-butyl(dimethyl)silyl]oxyethyl]purin-2-yl]piperazin-1-yl]phenol |
|---|---|
| PubChem CID | 164764185 |
| Molecular Formula | C30H38N8O2Si |
| Molecular Weight | 570.77 g/mol |
| Exact Mass | 570.29 |
| IUPAC Name | 4-[4-[6-(benzimidazol-1-yl)-9-[2-[tert-butyl(dimethyl)silyl]oxyethyl]purin-2-yl]piperazin-1-yl]phenol |
| SMILES | CC(C)(C)[Si](C)(C)OCCn1cnc2c(-n3cnc4ccccc43)nc(N3CCN(c4ccc(O)cc4)CC3)nc21 |
| InChI | InChI=1S/C30H38N8O2Si/c1-30(2,3)41(4,5)40-19-18-37-20-32-26-27(37)33-29(34-28(26)38-21-31-24-8-6-7-9-25(24)38)36-16-14-35(15-17-36)22-10-12-23(39)13-11-22/h6-13,20-21,39H,14-19H2,1-5H3 |
| InChIKey | YYDFTOKASXBSOK-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.77 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|