C22H21ClN6O2 — CID 155102768
2-chloro-3-[2-[4-(4-hydroxyphenyl)piperazin-1-yl]-6-methylpurin-9-yl]phenol (PubChem CID 155102768) has the molecular formula C22H21ClN6O2 and a molecular weight of 436.90 g/mol. Its IUPAC name is 2-chloro-3-[2-[4-(4-hydroxyphenyl)piperazin-1-yl]-6-methylpurin-9-yl]phenol.
| Compound Name | 2-chloro-3-[2-[4-(4-hydroxyphenyl)piperazin-1-yl]-6-methylpurin-9-yl]phenol |
|---|---|
| PubChem CID | 155102768 |
| Molecular Formula | C22H21ClN6O2 |
| Molecular Weight | 436.90 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 2-chloro-3-[2-[4-(4-hydroxyphenyl)piperazin-1-yl]-6-methylpurin-9-yl]phenol |
| SMILES | Cc1nc(N2CCN(c3ccc(O)cc3)CC2)nc2c1ncn2-c1cccc(O)c1Cl |
| InChI | InChI=1S/C22H21ClN6O2/c1-14-20-21(29(13-24-20)17-3-2-4-18(31)19(17)23)26-22(25-14)28-11-9-27(10-12-28)15-5-7-16(30)8-6-15/h2-8,13,30-31H,9-12H2,1H3 |
| InChIKey | IDJPPTAGOTWHJY-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.90 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |