C22H21N5OS — CID 135932597
4-[9-(4-methylphenyl)-6-thiomorpholin-4-ylpurin-2-yl]phenol (PubChem CID 135932597) has the molecular formula C22H21N5OS and a molecular weight of 403.51 g/mol. Its IUPAC name is 4-[9-(4-methylphenyl)-6-thiomorpholin-4-ylpurin-2-yl]phenol.
| Compound Name | 4-[9-(4-methylphenyl)-6-thiomorpholin-4-ylpurin-2-yl]phenol |
|---|---|
| PubChem CID | 135932597 |
| Molecular Formula | C22H21N5OS |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 4-[9-(4-methylphenyl)-6-thiomorpholin-4-ylpurin-2-yl]phenol |
| SMILES | Cc1ccc(-n2cnc3c(N4CCSCC4)nc(-c4ccc(O)cc4)nc32)cc1 |
| InChI | InChI=1S/C22H21N5OS/c1-15-2-6-17(7-3-15)27-14-23-19-21(26-10-12-29-13-11-26)24-20(25-22(19)27)16-4-8-18(28)9-5-16/h2-9,14,28H,10-13H2,1H3 |
| InChIKey | DYFHPXJXTIUELE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |