C23H23N7O3 — CID 155102713
methyl 4-[6-amino-2-[4-(4-hydroxyphenyl)piperazin-1-yl]purin-9-yl]benzoate (PubChem CID 155102713) has the molecular formula C23H23N7O3 and a molecular weight of 445.48 g/mol. Its IUPAC name is methyl 4-[6-amino-2-[4-(4-hydroxyphenyl)piperazin-1-yl]purin-9-yl]benzoate.
| Compound Name | methyl 4-[6-amino-2-[4-(4-hydroxyphenyl)piperazin-1-yl]purin-9-yl]benzoate |
|---|---|
| PubChem CID | 155102713 |
| Molecular Formula | C23H23N7O3 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | methyl 4-[6-amino-2-[4-(4-hydroxyphenyl)piperazin-1-yl]purin-9-yl]benzoate |
| SMILES | COC(=O)c1ccc(-n2cnc3c(N)nc(N4CCN(c5ccc(O)cc5)CC4)nc32)cc1 |
| InChI | InChI=1S/C23H23N7O3/c1-33-22(32)15-2-4-17(5-3-15)30-14-25-19-20(24)26-23(27-21(19)30)29-12-10-28(11-13-29)16-6-8-18(31)9-7-16/h2-9,14,31H,10-13H2,1H3,(H2,24,26,27) |
| InChIKey | NCPQQMJWNNNMRI-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 122.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |