C23H24N8O2 — CID 155102861
4-[6-amino-2-[4-(4-hydroxyphenyl)piperazin-1-yl]purin-9-yl]-N-methylbenzamide (PubChem CID 155102861) has the molecular formula C23H24N8O2 and a molecular weight of 444.50 g/mol. Its IUPAC name is 4-[6-amino-2-[4-(4-hydroxyphenyl)piperazin-1-yl]purin-9-yl]-N-methylbenzamide.
| Compound Name | 4-[6-amino-2-[4-(4-hydroxyphenyl)piperazin-1-yl]purin-9-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 155102861 |
| Molecular Formula | C23H24N8O2 |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 4-[6-amino-2-[4-(4-hydroxyphenyl)piperazin-1-yl]purin-9-yl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(-n2cnc3c(N)nc(N4CCN(c5ccc(O)cc5)CC4)nc32)cc1 |
| InChI | InChI=1S/C23H24N8O2/c1-25-22(33)15-2-4-17(5-3-15)31-14-26-19-20(24)27-23(28-21(19)31)30-12-10-29(11-13-30)16-6-8-18(32)9-7-16/h2-9,14,32H,10-13H2,1H3,(H,25,33)(H2,24,27,28) |
| InChIKey | AOEHEWSZLNVPMQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |