C25H24N8O3 — CID 155102684
2-[2-[4-(4-hydroxyphenyl)piperazin-1-yl]-6-indazol-2-ylpurin-9-yl]propanoic acid (PubChem CID 155102684) has the molecular formula C25H24N8O3 and a molecular weight of 484.52 g/mol. Its IUPAC name is 2-[2-[4-(4-hydroxyphenyl)piperazin-1-yl]-6-indazol-2-ylpurin-9-yl]propanoic acid.
| Compound Name | 2-[2-[4-(4-hydroxyphenyl)piperazin-1-yl]-6-indazol-2-ylpurin-9-yl]propanoic acid |
|---|---|
| PubChem CID | 155102684 |
| Molecular Formula | C25H24N8O3 |
| Molecular Weight | 484.52 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | 2-[2-[4-(4-hydroxyphenyl)piperazin-1-yl]-6-indazol-2-ylpurin-9-yl]propanoic acid |
| SMILES | CC(C(=O)O)n1cnc2c(-n3cc4ccccc4n3)nc(N3CCN(c4ccc(O)cc4)CC3)nc21 |
| InChI | InChI=1S/C25H24N8O3/c1-16(24(35)36)32-15-26-21-22(32)27-25(28-23(21)33-14-17-4-2-3-5-20(17)29-33)31-12-10-30(11-13-31)18-6-8-19(34)9-7-18/h2-9,14-16,34H,10-13H2,1H3,(H,35,36) |
| InChIKey | PISMAOANVMDZHP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.52 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |