C16H22N6O4 — CID 53320439
2-[6-morpholin-4-yl-2-(pentanoylamino)purin-9-yl]acetic acid (PubChem CID 53320439) has the molecular formula C16H22N6O4 and a molecular weight of 362.39 g/mol. Its IUPAC name is 2-[6-morpholin-4-yl-2-(pentanoylamino)purin-9-yl]acetic acid.
| Compound Name | 2-[6-morpholin-4-yl-2-(pentanoylamino)purin-9-yl]acetic acid |
|---|---|
| PubChem CID | 53320439 |
| Molecular Formula | C16H22N6O4 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 2-[6-morpholin-4-yl-2-(pentanoylamino)purin-9-yl]acetic acid |
| SMILES | CCCCC(=O)Nc1nc(N2CCOCC2)c2ncn(CC(=O)O)c2n1 |
| InChI | InChI=1S/C16H22N6O4/c1-2-3-4-11(23)18-16-19-14(21-5-7-26-8-6-21)13-15(20-16)22(10-17-13)9-12(24)25/h10H,2-9H2,1H3,(H,24,25)(H,18,19,20,23) |
| InChIKey | PGEYLKYCCKFDHZ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 122.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |