C28H34N6O6 — CID 67123173
3-[2-[(4-cyclohexylbenzoyl)amino]-6-morpholin-4-ylpurin-9-yl]-4-ethoxy-4-oxobutanoic acid (PubChem CID 67123173) has the molecular formula C28H34N6O6 and a molecular weight of 550.62 g/mol. Its IUPAC name is 3-[2-[(4-cyclohexylbenzoyl)amino]-6-morpholin-4-ylpurin-9-yl]-4-ethoxy-4-oxobutanoic acid.
| Compound Name | 3-[2-[(4-cyclohexylbenzoyl)amino]-6-morpholin-4-ylpurin-9-yl]-4-ethoxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 67123173 |
| Molecular Formula | C28H34N6O6 |
| Molecular Weight | 550.62 g/mol |
| Exact Mass | 550.25 |
| IUPAC Name | 3-[2-[(4-cyclohexylbenzoyl)amino]-6-morpholin-4-ylpurin-9-yl]-4-ethoxy-4-oxobutanoic acid |
| SMILES | CCOC(=O)C(CC(=O)O)n1cnc2c(N3CCOCC3)nc(NC(=O)c3ccc(C4CCCCC4)cc3)nc21 |
| InChI | InChI=1S/C28H34N6O6/c1-2-40-27(38)21(16-22(35)36)34-17-29-23-24(33-12-14-39-15-13-33)30-28(31-25(23)34)32-26(37)20-10-8-19(9-11-20)18-6-4-3-5-7-18/h8-11,17-18,21H,2-7,12-16H2,1H3,(H,35,36)(H,30,31,32,37) |
| InChIKey | SNDDNEVMORIBLW-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 148.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.62 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |