C22H29N9O3S — CID 174079835
3-amino-N'-(dimethylsulfamoyl)-N-(9-ethyl-6-morpholin-4-ylpurin-2-yl)-3-phenylprop-2-enimidamide (PubChem CID 174079835) has the molecular formula C22H29N9O3S and a molecular weight of 499.60 g/mol. Its IUPAC name is 3-amino-N'-(dimethylsulfamoyl)-N-(9-ethyl-6-morpholin-4-ylpurin-2-yl)-3-phenylprop-2-enimidamide.
| Compound Name | 3-amino-N'-(dimethylsulfamoyl)-N-(9-ethyl-6-morpholin-4-ylpurin-2-yl)-3-phenylprop-2-enimidamide |
|---|---|
| PubChem CID | 174079835 |
| Molecular Formula | C22H29N9O3S |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | 3-amino-N'-(dimethylsulfamoyl)-N-(9-ethyl-6-morpholin-4-ylpurin-2-yl)-3-phenylprop-2-enimidamide |
| SMILES | CCn1cnc2c(N3CCOCC3)nc(NC(C=C(N)c3ccccc3)=NS(=O)(=O)N(C)C)nc21 |
| InChI | InChI=1S/C22H29N9O3S/c1-4-30-15-24-19-20(30)26-22(27-21(19)31-10-12-34-13-11-31)25-18(28-35(32,33)29(2)3)14-17(23)16-8-6-5-7-9-16/h5-9,14-15H,4,10-13,23H2,1-3H3,(H,25,26,27,28) |
| InChIKey | NLIUHNIGLRLUOF-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 143.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|