C26H28N8O — CID 168921334
(1Z,3E)-3-(9-ethyl-6-morpholin-4-yl-8-pyridin-4-ylpurin-2-yl)-1-phenylbuta-1,3-diene-1,4-diamine (PubChem CID 168921334) has the molecular formula C26H28N8O and a molecular weight of 468.57 g/mol. Its IUPAC name is (1Z,3E)-3-(9-ethyl-6-morpholin-4-yl-8-pyridin-4-ylpurin-2-yl)-1-phenylbuta-1,3-diene-1,4-diamine.
| Compound Name | (1Z,3E)-3-(9-ethyl-6-morpholin-4-yl-8-pyridin-4-ylpurin-2-yl)-1-phenylbuta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 168921334 |
| Molecular Formula | C26H28N8O |
| Molecular Weight | 468.57 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | (1Z,3E)-3-(9-ethyl-6-morpholin-4-yl-8-pyridin-4-ylpurin-2-yl)-1-phenylbuta-1,3-diene-1,4-diamine |
| SMILES | CCn1c(-c2ccncc2)nc2c(N3CCOCC3)nc(C(/C=C(\N)c3ccccc3)=C/N)nc21 |
| InChI | InChI=1S/C26H28N8O/c1-2-34-24(19-8-10-29-11-9-19)30-22-25(33-12-14-35-15-13-33)31-23(32-26(22)34)20(17-27)16-21(28)18-6-4-3-5-7-18/h3-11,16-17H,2,12-15,27-28H2,1H3/b20-17+,21-16- |
| InChIKey | CJVWJNJDPXFEAQ-OHDIYIDUSA-N |
| XLogP | 3.04 |
| TPSA | 121.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.57 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|