C27H26N8O — CID 168921146
4-[9-ethyl-2-(6-methyl-5-phenylpyridazin-3-yl)-8-pyridin-4-ylpurin-6-yl]morpholine (PubChem CID 168921146) has the molecular formula C27H26N8O and a molecular weight of 478.56 g/mol. Its IUPAC name is 4-[9-ethyl-2-(6-methyl-5-phenylpyridazin-3-yl)-8-pyridin-4-ylpurin-6-yl]morpholine.
| Compound Name | 4-[9-ethyl-2-(6-methyl-5-phenylpyridazin-3-yl)-8-pyridin-4-ylpurin-6-yl]morpholine |
|---|---|
| PubChem CID | 168921146 |
| Molecular Formula | C27H26N8O |
| Molecular Weight | 478.56 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | 4-[9-ethyl-2-(6-methyl-5-phenylpyridazin-3-yl)-8-pyridin-4-ylpurin-6-yl]morpholine |
| SMILES | CCn1c(-c2ccncc2)nc2c(N3CCOCC3)nc(-c3cc(-c4ccccc4)c(C)nn3)nc21 |
| InChI | InChI=1S/C27H26N8O/c1-3-35-25(20-9-11-28-12-10-20)29-23-26(34-13-15-36-16-14-34)30-24(31-27(23)35)22-17-21(18(2)32-33-22)19-7-5-4-6-8-19/h4-12,17H,3,13-16H2,1-2H3 |
| InChIKey | UMHDGVPDATUFRC-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 94.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.56 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |