C20H22N8O — CID 168921077
4-[2-(1-ethylpyrazol-3-yl)-9-methyl-8-pyridin-4-ylpurin-6-yl]morpholine (PubChem CID 168921077) has the molecular formula C20H22N8O and a molecular weight of 390.45 g/mol. Its IUPAC name is 4-[2-(1-ethylpyrazol-3-yl)-9-methyl-8-pyridin-4-ylpurin-6-yl]morpholine.
| Compound Name | 4-[2-(1-ethylpyrazol-3-yl)-9-methyl-8-pyridin-4-ylpurin-6-yl]morpholine |
|---|---|
| PubChem CID | 168921077 |
| Molecular Formula | C20H22N8O |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 4-[2-(1-ethylpyrazol-3-yl)-9-methyl-8-pyridin-4-ylpurin-6-yl]morpholine |
| SMILES | CCn1ccc(-c2nc(N3CCOCC3)c3nc(-c4ccncc4)n(C)c3n2)n1 |
| InChI | InChI=1S/C20H22N8O/c1-3-28-9-6-15(25-28)17-23-19-16(20(24-17)27-10-12-29-13-11-27)22-18(26(19)2)14-4-7-21-8-5-14/h4-9H,3,10-13H2,1-2H3 |
| InChIKey | IUXDTJXFWDSYKJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 86.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |