C21H22IN7O — CID 168921038
4-[9-ethyl-8-iodo-2-[3-(1-methylpyrazol-3-yl)phenyl]purin-6-yl]morpholine (PubChem CID 168921038) has the molecular formula C21H22IN7O and a molecular weight of 515.36 g/mol. Its IUPAC name is 4-[9-ethyl-8-iodo-2-[3-(1-methylpyrazol-3-yl)phenyl]purin-6-yl]morpholine.
| Compound Name | 4-[9-ethyl-8-iodo-2-[3-(1-methylpyrazol-3-yl)phenyl]purin-6-yl]morpholine |
|---|---|
| PubChem CID | 168921038 |
| Molecular Formula | C21H22IN7O |
| Molecular Weight | 515.36 g/mol |
| Exact Mass | 515.09 |
| IUPAC Name | 4-[9-ethyl-8-iodo-2-[3-(1-methylpyrazol-3-yl)phenyl]purin-6-yl]morpholine |
| SMILES | CCn1c(I)nc2c(N3CCOCC3)nc(-c3cccc(-c4ccn(C)n4)c3)nc21 |
| InChI | InChI=1S/C21H22IN7O/c1-3-29-20-17(23-21(29)22)19(28-9-11-30-12-10-28)24-18(25-20)15-6-4-5-14(13-15)16-7-8-27(2)26-16/h4-8,13H,3,9-12H2,1-2H3 |
| InChIKey | BIAWHJUCRBMJBE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 73.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|