C26H24N8O — CID 168921480
4-[9-ethyl-2-(4-phenylpyridazin-3-yl)-8-pyridin-4-ylpurin-6-yl]morpholine (PubChem CID 168921480) has the molecular formula C26H24N8O and a molecular weight of 464.53 g/mol. Its IUPAC name is 4-[9-ethyl-2-(4-phenylpyridazin-3-yl)-8-pyridin-4-ylpurin-6-yl]morpholine.
| Compound Name | 4-[9-ethyl-2-(4-phenylpyridazin-3-yl)-8-pyridin-4-ylpurin-6-yl]morpholine |
|---|---|
| PubChem CID | 168921480 |
| Molecular Formula | C26H24N8O |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 4-[9-ethyl-2-(4-phenylpyridazin-3-yl)-8-pyridin-4-ylpurin-6-yl]morpholine |
| SMILES | CCn1c(-c2ccncc2)nc2c(N3CCOCC3)nc(-c3nnccc3-c3ccccc3)nc21 |
| InChI | InChI=1S/C26H24N8O/c1-2-34-24(19-8-11-27-12-9-19)29-22-25(33-14-16-35-17-15-33)30-23(31-26(22)34)21-20(10-13-28-32-21)18-6-4-3-5-7-18/h3-13H,2,14-17H2,1H3 |
| InChIKey | KDTYNTPZKIGEHU-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 94.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |