C24H28N8O2 — CID 168920984
4-[9-ethyl-2-[3-(oxan-4-yl)pyrazol-1-yl]-8-pyridin-4-ylpurin-6-yl]morpholine (PubChem CID 168920984) has the molecular formula C24H28N8O2 and a molecular weight of 460.54 g/mol. Its IUPAC name is 4-[9-ethyl-2-[3-(oxan-4-yl)pyrazol-1-yl]-8-pyridin-4-ylpurin-6-yl]morpholine.
| Compound Name | 4-[9-ethyl-2-[3-(oxan-4-yl)pyrazol-1-yl]-8-pyridin-4-ylpurin-6-yl]morpholine |
|---|---|
| PubChem CID | 168920984 |
| Molecular Formula | C24H28N8O2 |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | 4-[9-ethyl-2-[3-(oxan-4-yl)pyrazol-1-yl]-8-pyridin-4-ylpurin-6-yl]morpholine |
| SMILES | CCn1c(-c2ccncc2)nc2c(N3CCOCC3)nc(-n3ccc(C4CCOCC4)n3)nc21 |
| InChI | InChI=1S/C24H28N8O2/c1-2-31-21(18-3-8-25-9-4-18)26-20-22(30-11-15-34-16-12-30)27-24(28-23(20)31)32-10-5-19(29-32)17-6-13-33-14-7-17/h3-5,8-10,17H,2,6-7,11-16H2,1H3 |
| InChIKey | PCKLDLRZVGCZSN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 96.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |