C22H25N9O — CID 168921313
4-[9-methyl-8-pyridin-2-yl-2-(3-pyrrolidin-3-ylpyrazol-1-yl)purin-6-yl]morpholine (PubChem CID 168921313) has the molecular formula C22H25N9O and a molecular weight of 431.50 g/mol. Its IUPAC name is 4-[9-methyl-8-pyridin-2-yl-2-(3-pyrrolidin-3-ylpyrazol-1-yl)purin-6-yl]morpholine.
| Compound Name | 4-[9-methyl-8-pyridin-2-yl-2-(3-pyrrolidin-3-ylpyrazol-1-yl)purin-6-yl]morpholine |
|---|---|
| PubChem CID | 168921313 |
| Molecular Formula | C22H25N9O |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 4-[9-methyl-8-pyridin-2-yl-2-(3-pyrrolidin-3-ylpyrazol-1-yl)purin-6-yl]morpholine |
| SMILES | Cn1c(-c2ccccn2)nc2c(N3CCOCC3)nc(-n3ccc(C4CCNC4)n3)nc21 |
| InChI | InChI=1S/C22H25N9O/c1-29-19(17-4-2-3-7-24-17)25-18-20(29)26-22(27-21(18)30-10-12-32-13-11-30)31-9-6-16(28-31)15-5-8-23-14-15/h2-4,6-7,9,15,23H,5,8,10-14H2,1H3 |
| InChIKey | PCOBBZNHGJOPKC-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 98.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |