C17H22N8O2 — CID 168920860
4-[9-methyl-2-morpholin-4-yl-8-(1H-pyrazol-5-yl)purin-6-yl]morpholine (PubChem CID 168920860) has the molecular formula C17H22N8O2 and a molecular weight of 370.42 g/mol. Its IUPAC name is 4-[9-methyl-2-morpholin-4-yl-8-(1H-pyrazol-5-yl)purin-6-yl]morpholine.
| Compound Name | 4-[9-methyl-2-morpholin-4-yl-8-(1H-pyrazol-5-yl)purin-6-yl]morpholine |
|---|---|
| PubChem CID | 168920860 |
| Molecular Formula | C17H22N8O2 |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 4-[9-methyl-2-morpholin-4-yl-8-(1H-pyrazol-5-yl)purin-6-yl]morpholine |
| SMILES | Cn1c(-c2ccn[nH]2)nc2c(N3CCOCC3)nc(N3CCOCC3)nc21 |
| InChI | InChI=1S/C17H22N8O2/c1-23-14(12-2-3-18-22-12)19-13-15(23)20-17(25-6-10-27-11-7-25)21-16(13)24-4-8-26-9-5-24/h2-3H,4-11H2,1H3,(H,18,22) |
| InChIKey | IXDLHDOVUUTELJ-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |