C11H14ClN5O — CID 59806507
4-(2-chloro-8,9-dimethylpurin-6-yl)morpholine (PubChem CID 59806507) has the molecular formula C11H14ClN5O and a molecular weight of 267.72 g/mol. Its IUPAC name is 4-(2-chloro-8,9-dimethylpurin-6-yl)morpholine.
| Compound Name | 4-(2-chloro-8,9-dimethylpurin-6-yl)morpholine |
|---|---|
| PubChem CID | 59806507 |
| Molecular Formula | C11H14ClN5O |
| Molecular Weight | 267.72 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 4-(2-chloro-8,9-dimethylpurin-6-yl)morpholine |
| SMILES | Cc1nc2c(N3CCOCC3)nc(Cl)nc2n1C |
| InChI | InChI=1S/C11H14ClN5O/c1-7-13-8-9(16(7)2)14-11(12)15-10(8)17-3-5-18-6-4-17/h3-6H2,1-2H3 |
| InChIKey | DTDZSAQMTMXCCV-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.72 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |