C18H27ClN6O2 — CID 59605651
2-[1-[2-(2-chloro-9-methyl-6-morpholin-4-ylpurin-8-yl)ethyl]azetidin-3-yl]propan-2-ol (PubChem CID 59605651) has the molecular formula C18H27ClN6O2 and a molecular weight of 394.91 g/mol. Its IUPAC name is 2-[1-[2-(2-chloro-9-methyl-6-morpholin-4-ylpurin-8-yl)ethyl]azetidin-3-yl]propan-2-ol.
| Compound Name | 2-[1-[2-(2-chloro-9-methyl-6-morpholin-4-ylpurin-8-yl)ethyl]azetidin-3-yl]propan-2-ol |
|---|---|
| PubChem CID | 59605651 |
| Molecular Formula | C18H27ClN6O2 |
| Molecular Weight | 394.91 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 2-[1-[2-(2-chloro-9-methyl-6-morpholin-4-ylpurin-8-yl)ethyl]azetidin-3-yl]propan-2-ol |
| SMILES | Cn1c(CCN2CC(C(C)(C)O)C2)nc2c(N3CCOCC3)nc(Cl)nc21 |
| InChI | InChI=1S/C18H27ClN6O2/c1-18(2,26)12-10-24(11-12)5-4-13-20-14-15(23(13)3)21-17(19)22-16(14)25-6-8-27-9-7-25/h12,26H,4-11H2,1-3H3 |
| InChIKey | ZULPTFWQHFPAJM-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.91 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |