C18H26ClN7O4 — CID 162624283
(2-chloro-9-methyl-6-morpholin-4-ylpurin-8-yl)methyl N-(2-morpholin-4-ylethyl)carbamate (PubChem CID 162624283) has the molecular formula C18H26ClN7O4 and a molecular weight of 439.90 g/mol. Its IUPAC name is (2-chloro-9-methyl-6-morpholin-4-ylpurin-8-yl)methyl N-(2-morpholin-4-ylethyl)carbamate.
| Compound Name | (2-chloro-9-methyl-6-morpholin-4-ylpurin-8-yl)methyl N-(2-morpholin-4-ylethyl)carbamate |
|---|---|
| PubChem CID | 162624283 |
| Molecular Formula | C18H26ClN7O4 |
| Molecular Weight | 439.90 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | (2-chloro-9-methyl-6-morpholin-4-ylpurin-8-yl)methyl N-(2-morpholin-4-ylethyl)carbamate |
| SMILES | Cn1c(COC(=O)NCCN2CCOCC2)nc2c(N3CCOCC3)nc(Cl)nc21 |
| InChI | InChI=1S/C18H26ClN7O4/c1-24-13(12-30-18(27)20-2-3-25-4-8-28-9-5-25)21-14-15(24)22-17(19)23-16(14)26-6-10-29-11-7-26/h2-12H2,1H3,(H,20,27) |
| InChIKey | WDBAYDLDRIQWKJ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.90 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |