C12H14ClN5O3 — CID 123591133
3-(2-chloro-6-morpholin-4-ylpurin-9-yl)propanoic acid (PubChem CID 123591133) has the molecular formula C12H14ClN5O3 and a molecular weight of 311.73 g/mol. Its IUPAC name is 3-(2-chloro-6-morpholin-4-ylpurin-9-yl)propanoic acid.
| Compound Name | 3-(2-chloro-6-morpholin-4-ylpurin-9-yl)propanoic acid |
|---|---|
| PubChem CID | 123591133 |
| Molecular Formula | C12H14ClN5O3 |
| Molecular Weight | 311.73 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 3-(2-chloro-6-morpholin-4-ylpurin-9-yl)propanoic acid |
| SMILES | O=C(O)CCn1cnc2c(N3CCOCC3)nc(Cl)nc21 |
| InChI | InChI=1S/C12H14ClN5O3/c13-12-15-10(17-3-5-21-6-4-17)9-11(16-12)18(7-14-9)2-1-8(19)20/h7H,1-6H2,(H,19,20) |
| InChIKey | HFZJEILGGSHTRA-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.73 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |