C16H24ClN7O3S — CID 174631488
[4-[(2-chloro-9-methyl-6-morpholin-4-ylpurin-8-yl)methyl]piperazin-1-yl]methanesulfinic acid (PubChem CID 174631488) has the molecular formula C16H24ClN7O3S and a molecular weight of 429.93 g/mol. Its IUPAC name is [4-[(2-chloro-9-methyl-6-morpholin-4-ylpurin-8-yl)methyl]piperazin-1-yl]methanesulfinic acid.
| Compound Name | [4-[(2-chloro-9-methyl-6-morpholin-4-ylpurin-8-yl)methyl]piperazin-1-yl]methanesulfinic acid |
|---|---|
| PubChem CID | 174631488 |
| Molecular Formula | C16H24ClN7O3S |
| Molecular Weight | 429.93 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | [4-[(2-chloro-9-methyl-6-morpholin-4-ylpurin-8-yl)methyl]piperazin-1-yl]methanesulfinic acid |
| SMILES | Cn1c(CN2CCN(CS(=O)O)CC2)nc2c(N3CCOCC3)nc(Cl)nc21 |
| InChI | InChI=1S/C16H24ClN7O3S/c1-21-12(10-22-2-4-23(5-3-22)11-28(25)26)18-13-14(21)19-16(17)20-15(13)24-6-8-27-9-7-24/h2-11H2,1H3,(H,25,26) |
| InChIKey | YHVAVCODXMJZQO-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.93 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|