C15H18ClN5O2 — CID 88581828
2-chloro-6,6,9-trimethyl-4-morpholin-4-ylpurino[8,9-c][1,4]oxazine (PubChem CID 88581828) has the molecular formula C15H18ClN5O2 and a molecular weight of 335.80 g/mol. Its IUPAC name is 2-chloro-6,6,9-trimethyl-4-morpholin-4-ylpurino[8,9-c][1,4]oxazine.
| Compound Name | 2-chloro-6,6,9-trimethyl-4-morpholin-4-ylpurino[8,9-c][1,4]oxazine |
|---|---|
| PubChem CID | 88581828 |
| Molecular Formula | C15H18ClN5O2 |
| Molecular Weight | 335.80 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 2-chloro-6,6,9-trimethyl-4-morpholin-4-ylpurino[8,9-c][1,4]oxazine |
| SMILES | CC1=COC(C)(C)c2nc3c(N4CCOCC4)nc(Cl)nc3n21 |
| InChI | InChI=1S/C15H18ClN5O2/c1-9-8-23-15(2,3)13-17-10-11(20-4-6-22-7-5-20)18-14(16)19-12(10)21(9)13/h8H,4-7H2,1-3H3 |
| InChIKey | VLRYEOVHNLMVRS-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 65.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.80 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |