C16H17ClN6O3S — CID 168921437
4-[2-chloro-9-(methylsulfonylmethyl)-8-pyridin-4-ylpurin-6-yl]morpholine (PubChem CID 168921437) has the molecular formula C16H17ClN6O3S and a molecular weight of 408.87 g/mol. Its IUPAC name is 4-[2-chloro-9-(methylsulfonylmethyl)-8-pyridin-4-ylpurin-6-yl]morpholine.
| Compound Name | 4-[2-chloro-9-(methylsulfonylmethyl)-8-pyridin-4-ylpurin-6-yl]morpholine |
|---|---|
| PubChem CID | 168921437 |
| Molecular Formula | C16H17ClN6O3S |
| Molecular Weight | 408.87 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | 4-[2-chloro-9-(methylsulfonylmethyl)-8-pyridin-4-ylpurin-6-yl]morpholine |
| SMILES | CS(=O)(=O)Cn1c(-c2ccncc2)nc2c(N3CCOCC3)nc(Cl)nc21 |
| InChI | InChI=1S/C16H17ClN6O3S/c1-27(24,25)10-23-13(11-2-4-18-5-3-11)19-12-14(20-16(17)21-15(12)23)22-6-8-26-9-7-22/h2-5H,6-10H2,1H3 |
| InChIKey | AFJWFLOZNRRHKF-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 103.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.87 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |