C17H18N6O3 — CID 168920808
9-ethyl-6-morpholin-4-yl-8-pyridin-4-ylpurine-2-carboxylic acid (PubChem CID 168920808) has the molecular formula C17H18N6O3 and a molecular weight of 354.37 g/mol. Its IUPAC name is 9-ethyl-6-morpholin-4-yl-8-pyridin-4-ylpurine-2-carboxylic acid.
| Compound Name | 9-ethyl-6-morpholin-4-yl-8-pyridin-4-ylpurine-2-carboxylic acid |
|---|---|
| PubChem CID | 168920808 |
| Molecular Formula | C17H18N6O3 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 9-ethyl-6-morpholin-4-yl-8-pyridin-4-ylpurine-2-carboxylic acid |
| SMILES | CCn1c(-c2ccncc2)nc2c(N3CCOCC3)nc(C(=O)O)nc21 |
| InChI | InChI=1S/C17H18N6O3/c1-2-23-14(11-3-5-18-6-4-11)19-12-15(22-7-9-26-10-8-22)20-13(17(24)25)21-16(12)23/h3-6H,2,7-10H2,1H3,(H,24,25) |
| InChIKey | BRLOFFLMANPMBM-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 106.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |