C23H26N8O2 — CID 168921646
1-[1-(9-ethyl-6-morpholin-4-yl-8-pyridin-4-ylpurin-2-yl)pyrazol-4-yl]cyclobutan-1-ol (PubChem CID 168921646) has the molecular formula C23H26N8O2 and a molecular weight of 446.52 g/mol. Its IUPAC name is 1-[1-(9-ethyl-6-morpholin-4-yl-8-pyridin-4-ylpurin-2-yl)pyrazol-4-yl]cyclobutan-1-ol.
| Compound Name | 1-[1-(9-ethyl-6-morpholin-4-yl-8-pyridin-4-ylpurin-2-yl)pyrazol-4-yl]cyclobutan-1-ol |
|---|---|
| PubChem CID | 168921646 |
| Molecular Formula | C23H26N8O2 |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | 1-[1-(9-ethyl-6-morpholin-4-yl-8-pyridin-4-ylpurin-2-yl)pyrazol-4-yl]cyclobutan-1-ol |
| SMILES | CCn1c(-c2ccncc2)nc2c(N3CCOCC3)nc(-n3cc(C4(O)CCC4)cn3)nc21 |
| InChI | InChI=1S/C23H26N8O2/c1-2-30-19(16-4-8-24-9-5-16)26-18-20(29-10-12-33-13-11-29)27-22(28-21(18)30)31-15-17(14-25-31)23(32)6-3-7-23/h4-5,8-9,14-15,32H,2-3,6-7,10-13H2,1H3 |
| InChIKey | GHBWWIFYTIXNRO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 107.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |