C20H22N8O2 — CID 168921657
4-[9-ethyl-2-(4-methoxypyrazol-1-yl)-8-pyridin-4-ylpurin-6-yl]morpholine (PubChem CID 168921657) has the molecular formula C20H22N8O2 and a molecular weight of 406.45 g/mol. Its IUPAC name is 4-[9-ethyl-2-(4-methoxypyrazol-1-yl)-8-pyridin-4-ylpurin-6-yl]morpholine.
| Compound Name | 4-[9-ethyl-2-(4-methoxypyrazol-1-yl)-8-pyridin-4-ylpurin-6-yl]morpholine |
|---|---|
| PubChem CID | 168921657 |
| Molecular Formula | C20H22N8O2 |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 4-[9-ethyl-2-(4-methoxypyrazol-1-yl)-8-pyridin-4-ylpurin-6-yl]morpholine |
| SMILES | CCn1c(-c2ccncc2)nc2c(N3CCOCC3)nc(-n3cc(OC)cn3)nc21 |
| InChI | InChI=1S/C20H22N8O2/c1-3-27-17(14-4-6-21-7-5-14)23-16-18(26-8-10-30-11-9-26)24-20(25-19(16)27)28-13-15(29-2)12-22-28/h4-7,12-13H,3,8-11H2,1-2H3 |
| InChIKey | MPLDXRBTYGPLIM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 96.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |