C19H20N8O3S — CID 168921591
4-[9-(methylsulfonylmethyl)-2-pyrazol-1-yl-8-pyridin-4-ylpurin-6-yl]morpholine (PubChem CID 168921591) has the molecular formula C19H20N8O3S and a molecular weight of 440.49 g/mol. Its IUPAC name is 4-[9-(methylsulfonylmethyl)-2-pyrazol-1-yl-8-pyridin-4-ylpurin-6-yl]morpholine.
| Compound Name | 4-[9-(methylsulfonylmethyl)-2-pyrazol-1-yl-8-pyridin-4-ylpurin-6-yl]morpholine |
|---|---|
| PubChem CID | 168921591 |
| Molecular Formula | C19H20N8O3S |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 4-[9-(methylsulfonylmethyl)-2-pyrazol-1-yl-8-pyridin-4-ylpurin-6-yl]morpholine |
| SMILES | CS(=O)(=O)Cn1c(-c2ccncc2)nc2c(N3CCOCC3)nc(-n3cccn3)nc21 |
| InChI | InChI=1S/C19H20N8O3S/c1-31(28,29)13-26-16(14-3-6-20-7-4-14)22-15-17(25-9-11-30-12-10-25)23-19(24-18(15)26)27-8-2-5-21-27/h2-8H,9-13H2,1H3 |
| InChIKey | WQUHOQUQYQEXLU-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 120.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |