C16H18N8O2 — CID 162379149
N'-hydroxy-9-methyl-6-morpholin-4-yl-8-pyridin-4-ylpurine-2-carboximidamide (PubChem CID 162379149) has the molecular formula C16H18N8O2 and a molecular weight of 354.37 g/mol. Its IUPAC name is N'-hydroxy-9-methyl-6-morpholin-4-yl-8-pyridin-4-ylpurine-2-carboximidamide.
| Compound Name | N'-hydroxy-9-methyl-6-morpholin-4-yl-8-pyridin-4-ylpurine-2-carboximidamide |
|---|---|
| PubChem CID | 162379149 |
| Molecular Formula | C16H18N8O2 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | N'-hydroxy-9-methyl-6-morpholin-4-yl-8-pyridin-4-ylpurine-2-carboximidamide |
| SMILES | Cn1c(-c2ccncc2)nc2c(N3CCOCC3)nc(/C(N)=N/O)nc21 |
| InChI | InChI=1S/C16H18N8O2/c1-23-14(10-2-4-18-5-3-10)19-11-15(23)20-13(12(17)22-25)21-16(11)24-6-8-26-9-7-24/h2-5,25H,6-9H2,1H3,(H2,17,22) |
| InChIKey | SOJWYGLXQZDHME-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 127.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|