C15H18ClN3O2S — CID 70676607
4-chloro-10,10-dimethyl-6-morpholin-4-yl-11-oxa-8-thia-3,5-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraene (PubChem CID 70676607) has the molecular formula C15H18ClN3O2S and a molecular weight of 339.85 g/mol. Its IUPAC name is 4-chloro-10,10-dimethyl-6-morpholin-4-yl-11-oxa-8-thia-3,5-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraene.
| Compound Name | 4-chloro-10,10-dimethyl-6-morpholin-4-yl-11-oxa-8-thia-3,5-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraene |
|---|---|
| PubChem CID | 70676607 |
| Molecular Formula | C15H18ClN3O2S |
| Molecular Weight | 339.85 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 4-chloro-10,10-dimethyl-6-morpholin-4-yl-11-oxa-8-thia-3,5-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraene |
| SMILES | CC1(C)OCCc2c1sc1c(N3CCOCC3)nc(Cl)nc21 |
| InChI | InChI=1S/C15H18ClN3O2S/c1-15(2)12-9(3-6-21-15)10-11(22-12)13(18-14(16)17-10)19-4-7-20-8-5-19/h3-8H2,1-2H3 |
| InChIKey | HXKPEAMIKFTMSF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.85 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |