C11H11Cl2N3OS — CID 66553795
4-[2-chloro-6-(chloromethyl)thieno[3,2-d]pyrimidin-4-yl]morpholine (PubChem CID 66553795) has the molecular formula C11H11Cl2N3OS and a molecular weight of 304.20 g/mol. Its IUPAC name is 4-[2-chloro-6-(chloromethyl)thieno[3,2-d]pyrimidin-4-yl]morpholine.
| Compound Name | 4-[2-chloro-6-(chloromethyl)thieno[3,2-d]pyrimidin-4-yl]morpholine |
|---|---|
| PubChem CID | 66553795 |
| Molecular Formula | C11H11Cl2N3OS |
| Molecular Weight | 304.20 g/mol |
| Exact Mass | 303.00 |
| IUPAC Name | 4-[2-chloro-6-(chloromethyl)thieno[3,2-d]pyrimidin-4-yl]morpholine |
| SMILES | ClCc1cc2nc(Cl)nc(N3CCOCC3)c2s1 |
| InChI | InChI=1S/C11H11Cl2N3OS/c12-6-7-5-8-9(18-7)10(15-11(13)14-8)16-1-3-17-4-2-16/h5H,1-4,6H2 |
| InChIKey | ZNATZJQLFVNUCL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.20 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|