C17H24ClN5O2S — CID 86619261
N-[(2-chloro-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl)methyl]-2-morpholin-4-ylethanamine (PubChem CID 86619261) has the molecular formula C17H24ClN5O2S and a molecular weight of 397.93 g/mol. Its IUPAC name is N-[(2-chloro-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl)methyl]-2-morpholin-4-ylethanamine.
| Compound Name | N-[(2-chloro-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl)methyl]-2-morpholin-4-ylethanamine |
|---|---|
| PubChem CID | 86619261 |
| Molecular Formula | C17H24ClN5O2S |
| Molecular Weight | 397.93 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | N-[(2-chloro-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl)methyl]-2-morpholin-4-ylethanamine |
| SMILES | Clc1nc(N2CCOCC2)c2sc(CNCCN3CCOCC3)cc2n1 |
| InChI | InChI=1S/C17H24ClN5O2S/c18-17-20-14-11-13(12-19-1-2-22-3-7-24-8-4-22)26-15(14)16(21-17)23-5-9-25-10-6-23/h11,19H,1-10,12H2 |
| InChIKey | KWARZIPIDJLKCV-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.93 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|