C16H24ClN5O3S2 — CID 86618450
3-[(2-chloro-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl)methylamino]-N,N-dimethylpropane-1-sulfonamide (PubChem CID 86618450) has the molecular formula C16H24ClN5O3S2 and a molecular weight of 433.99 g/mol. Its IUPAC name is 3-[(2-chloro-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl)methylamino]-N,N-dimethylpropane-1-sulfonamide.
| Compound Name | 3-[(2-chloro-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl)methylamino]-N,N-dimethylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 86618450 |
| Molecular Formula | C16H24ClN5O3S2 |
| Molecular Weight | 433.99 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | 3-[(2-chloro-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl)methylamino]-N,N-dimethylpropane-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)CCCNCc1cc2nc(Cl)nc(N3CCOCC3)c2s1 |
| InChI | InChI=1S/C16H24ClN5O3S2/c1-21(2)27(23,24)9-3-4-18-11-12-10-13-14(26-12)15(20-16(17)19-13)22-5-7-25-8-6-22/h10,18H,3-9,11H2,1-2H3 |
| InChIKey | PHMXCMGTQMZZPN-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.99 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|