C13H16ClN3O4S2 — CID 86618430
1-(2-chloro-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl)ethyl methanesulfonate (PubChem CID 86618430) has the molecular formula C13H16ClN3O4S2 and a molecular weight of 377.88 g/mol. Its IUPAC name is 1-(2-chloro-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl)ethyl methanesulfonate.
| Compound Name | 1-(2-chloro-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl)ethyl methanesulfonate |
|---|---|
| PubChem CID | 86618430 |
| Molecular Formula | C13H16ClN3O4S2 |
| Molecular Weight | 377.88 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | 1-(2-chloro-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl)ethyl methanesulfonate |
| SMILES | CC(OS(C)(=O)=O)c1cc2nc(Cl)nc(N3CCOCC3)c2s1 |
| InChI | InChI=1S/C13H16ClN3O4S2/c1-8(21-23(2,18)19)10-7-9-11(22-10)12(16-13(14)15-9)17-3-5-20-6-4-17/h7-8H,3-6H2,1-2H3 |
| InChIKey | PMENWLBULSERCS-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 81.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.88 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|