C13H15ClN4O2S — CID 86618387
N-(2-chloro-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl)propanamide (PubChem CID 86618387) has the molecular formula C13H15ClN4O2S and a molecular weight of 326.81 g/mol. Its IUPAC name is N-(2-chloro-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl)propanamide.
| Compound Name | N-(2-chloro-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl)propanamide |
|---|---|
| PubChem CID | 86618387 |
| Molecular Formula | C13H15ClN4O2S |
| Molecular Weight | 326.81 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | N-(2-chloro-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl)propanamide |
| SMILES | CCC(=O)Nc1cc2nc(Cl)nc(N3CCOCC3)c2s1 |
| InChI | InChI=1S/C13H15ClN4O2S/c1-2-9(19)16-10-7-8-11(21-10)12(17-13(14)15-8)18-3-5-20-6-4-18/h7H,2-6H2,1H3,(H,16,19) |
| InChIKey | DYJUUJVXAPYHQJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.81 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |