C20H19ClN4O5S2 — CID 86682145
methyl (E)-3-[4-[(2-chloro-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl)sulfamoyl]phenyl]prop-2-enoate (PubChem CID 86682145) has the molecular formula C20H19ClN4O5S2 and a molecular weight of 494.98 g/mol. Its IUPAC name is methyl (E)-3-[4-[(2-chloro-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl)sulfamoyl]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[4-[(2-chloro-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl)sulfamoyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 86682145 |
| Molecular Formula | C20H19ClN4O5S2 |
| Molecular Weight | 494.98 g/mol |
| Exact Mass | 494.05 |
| IUPAC Name | methyl (E)-3-[4-[(2-chloro-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl)sulfamoyl]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc(S(=O)(=O)Nc2cc3nc(Cl)nc(N4CCOCC4)c3s2)cc1 |
| InChI | InChI=1S/C20H19ClN4O5S2/c1-29-17(26)7-4-13-2-5-14(6-3-13)32(27,28)24-16-12-15-18(31-16)19(23-20(21)22-15)25-8-10-30-11-9-25/h2-7,12,24H,8-11H2,1H3/b7-4+ |
| InChIKey | MXLHINFDSYQAKG-QPJJXVBHSA-N |
| XLogP | 3.17 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.98 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|