C34H38N6O3 — CID 159575760
N-[3-[4-amino-6-[(4-morpholin-4-ylphenyl)methyl]-1,3,5-triazin-2-yl]-2-(hydroxymethyl)phenyl]-4-cyclohexylbenzamide (PubChem CID 159575760) has the molecular formula C34H38N6O3 and a molecular weight of 578.72 g/mol. Its IUPAC name is N-[3-[4-amino-6-[(4-morpholin-4-ylphenyl)methyl]-1,3,5-triazin-2-yl]-2-(hydroxymethyl)phenyl]-4-cyclohexylbenzamide.
| Compound Name | N-[3-[4-amino-6-[(4-morpholin-4-ylphenyl)methyl]-1,3,5-triazin-2-yl]-2-(hydroxymethyl)phenyl]-4-cyclohexylbenzamide |
|---|---|
| PubChem CID | 159575760 |
| Molecular Formula | C34H38N6O3 |
| Molecular Weight | 578.72 g/mol |
| Exact Mass | 578.30 |
| IUPAC Name | N-[3-[4-amino-6-[(4-morpholin-4-ylphenyl)methyl]-1,3,5-triazin-2-yl]-2-(hydroxymethyl)phenyl]-4-cyclohexylbenzamide |
| SMILES | Nc1nc(Cc2ccc(N3CCOCC3)cc2)nc(-c2cccc(NC(=O)c3ccc(C4CCCCC4)cc3)c2CO)n1 |
| InChI | InChI=1S/C34H38N6O3/c35-34-38-31(21-23-9-15-27(16-10-23)40-17-19-43-20-18-40)37-32(39-34)28-7-4-8-30(29(28)22-41)36-33(42)26-13-11-25(12-14-26)24-5-2-1-3-6-24/h4,7-16,24,41H,1-3,5-6,17-22H2,(H,36,42)(H2,35,37,38,39) |
| InChIKey | MIJOZQYGZVUHCS-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.72 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|