C32H34N6O3S — CID 147888504
2-[3-[4-amino-6-[(4-morpholin-4-ylphenyl)methyl]-1,3,5-triazin-2-yl]-2-(hydroxymethyl)phenyl]-3,4,5,6,7,8-hexahydro-[1]benzothiolo[2,3-c]pyridin-1-one (PubChem CID 147888504) has the molecular formula C32H34N6O3S and a molecular weight of 582.73 g/mol. Its IUPAC name is 2-[3-[4-amino-6-[(4-morpholin-4-ylphenyl)methyl]-1,3,5-triazin-2-yl]-2-(hydroxymethyl)phenyl]-3,4,5,6,7,8-hexahydro-[1]benzothiolo[2,3-c]pyridin-1-one.
| Compound Name | 2-[3-[4-amino-6-[(4-morpholin-4-ylphenyl)methyl]-1,3,5-triazin-2-yl]-2-(hydroxymethyl)phenyl]-3,4,5,6,7,8-hexahydro-[1]benzothiolo[2,3-c]pyridin-1-one |
|---|---|
| PubChem CID | 147888504 |
| Molecular Formula | C32H34N6O3S |
| Molecular Weight | 582.73 g/mol |
| Exact Mass | 582.24 |
| IUPAC Name | 2-[3-[4-amino-6-[(4-morpholin-4-ylphenyl)methyl]-1,3,5-triazin-2-yl]-2-(hydroxymethyl)phenyl]-3,4,5,6,7,8-hexahydro-[1]benzothiolo[2,3-c]pyridin-1-one |
| SMILES | Nc1nc(Cc2ccc(N3CCOCC3)cc2)nc(-c2cccc(N3CCc4c(sc5c4CCCC5)C3=O)c2CO)n1 |
| InChI | InChI=1S/C32H34N6O3S/c33-32-35-28(18-20-8-10-21(11-9-20)37-14-16-41-17-15-37)34-30(36-32)24-5-3-6-26(25(24)19-39)38-13-12-23-22-4-1-2-7-27(22)42-29(23)31(38)40/h3,5-6,8-11,39H,1-2,4,7,12-19H2,(H2,33,34,35,36) |
| InChIKey | IBUPHVOKRSSMDK-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.73 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|