C25H24N4O2 — CID 121149343
N-[2-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]-4-morpholin-4-ylbenzamide (PubChem CID 121149343) has the molecular formula C25H24N4O2 and a molecular weight of 412.49 g/mol. Its IUPAC name is N-[2-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]-4-morpholin-4-ylbenzamide.
| Compound Name | N-[2-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]-4-morpholin-4-ylbenzamide |
|---|---|
| PubChem CID | 121149343 |
| Molecular Formula | C25H24N4O2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | N-[2-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]-4-morpholin-4-ylbenzamide |
| SMILES | Cc1cccn2cc(-c3ccccc3NC(=O)c3ccc(N4CCOCC4)cc3)nc12 |
| InChI | InChI=1S/C25H24N4O2/c1-18-5-4-12-29-17-23(26-24(18)29)21-6-2-3-7-22(21)27-25(30)19-8-10-20(11-9-19)28-13-15-31-16-14-28/h2-12,17H,13-16H2,1H3,(H,27,30) |
| InChIKey | RTHINMRKTNWOSK-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |