C24H24N4O — CID 121149854
1-[2-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]-3-(3-phenylpropyl)urea (PubChem CID 121149854) has the molecular formula C24H24N4O and a molecular weight of 384.48 g/mol. Its IUPAC name is 1-[2-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]-3-(3-phenylpropyl)urea.
| Compound Name | 1-[2-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]-3-(3-phenylpropyl)urea |
|---|---|
| PubChem CID | 121149854 |
| Molecular Formula | C24H24N4O |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 1-[2-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]-3-(3-phenylpropyl)urea |
| SMILES | Cc1cccn2cc(-c3ccccc3NC(=O)NCCCc3ccccc3)nc12 |
| InChI | InChI=1S/C24H24N4O/c1-18-9-8-16-28-17-22(26-23(18)28)20-13-5-6-14-21(20)27-24(29)25-15-7-12-19-10-3-2-4-11-19/h2-6,8-11,13-14,16-17H,7,12,15H2,1H3,(H2,25,27,29) |
| InChIKey | WRZWLKLPDYUWEK-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 58.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|