C22H26ClN5O2 — CID 56595891
ethyl 2-[6-chloro-2-[(4-cyclohexylphenyl)methylamino]purin-9-yl]acetate (PubChem CID 56595891) has the molecular formula C22H26ClN5O2 and a molecular weight of 427.94 g/mol. Its IUPAC name is ethyl 2-[6-chloro-2-[(4-cyclohexylphenyl)methylamino]purin-9-yl]acetate.
| Compound Name | ethyl 2-[6-chloro-2-[(4-cyclohexylphenyl)methylamino]purin-9-yl]acetate |
|---|---|
| PubChem CID | 56595891 |
| Molecular Formula | C22H26ClN5O2 |
| Molecular Weight | 427.94 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | ethyl 2-[6-chloro-2-[(4-cyclohexylphenyl)methylamino]purin-9-yl]acetate |
| SMILES | CCOC(=O)Cn1cnc2c(Cl)nc(NCc3ccc(C4CCCCC4)cc3)nc21 |
| InChI | InChI=1S/C22H26ClN5O2/c1-2-30-18(29)13-28-14-25-19-20(23)26-22(27-21(19)28)24-12-15-8-10-17(11-9-15)16-6-4-3-5-7-16/h8-11,14,16H,2-7,12-13H2,1H3,(H,24,26,27) |
| InChIKey | AACYXLOMYIGEGH-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.94 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |