C24H32N8O2 — CID 155546515
(E)-3-[3-[[[9-butyl-2-(4-methylpiperazin-1-yl)purin-6-yl]amino]methyl]phenyl]-N-hydroxyprop-2-enamide (PubChem CID 155546515) has the molecular formula C24H32N8O2 and a molecular weight of 464.57 g/mol. Its IUPAC name is (E)-3-[3-[[[9-butyl-2-(4-methylpiperazin-1-yl)purin-6-yl]amino]methyl]phenyl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[3-[[[9-butyl-2-(4-methylpiperazin-1-yl)purin-6-yl]amino]methyl]phenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 155546515 |
| Molecular Formula | C24H32N8O2 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | (E)-3-[3-[[[9-butyl-2-(4-methylpiperazin-1-yl)purin-6-yl]amino]methyl]phenyl]-N-hydroxyprop-2-enamide |
| SMILES | CCCCn1cnc2c(NCc3cccc(/C=C/C(=O)NO)c3)nc(N3CCN(C)CC3)nc21 |
| InChI | InChI=1S/C24H32N8O2/c1-3-4-10-32-17-26-21-22(27-24(28-23(21)32)31-13-11-30(2)12-14-31)25-16-19-7-5-6-18(15-19)8-9-20(33)29-34/h5-9,15,17,34H,3-4,10-14,16H2,1-2H3,(H,29,33)(H,25,27,28)/b9-8+ |
| InChIKey | XQWUVQCEGRUELT-CMDGGOBGSA-N |
| XLogP | 2.51 |
| TPSA | 111.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|