C24H25N7O2 — CID 159646523
1-[4-[[2-(6-amino-3-pyridinyl)-6-morpholin-4-ylpurin-9-yl]methyl]phenyl]propan-1-one (PubChem CID 159646523) has the molecular formula C24H25N7O2 and a molecular weight of 443.51 g/mol. Its IUPAC name is 1-[4-[[2-(6-amino-3-pyridinyl)-6-morpholin-4-ylpurin-9-yl]methyl]phenyl]propan-1-one.
| Compound Name | 1-[4-[[2-(6-amino-3-pyridinyl)-6-morpholin-4-ylpurin-9-yl]methyl]phenyl]propan-1-one |
|---|---|
| PubChem CID | 159646523 |
| Molecular Formula | C24H25N7O2 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | 1-[4-[[2-(6-amino-3-pyridinyl)-6-morpholin-4-ylpurin-9-yl]methyl]phenyl]propan-1-one |
| SMILES | CCC(=O)c1ccc(Cn2cnc3c(N4CCOCC4)nc(-c4ccc(N)nc4)nc32)cc1 |
| InChI | InChI=1S/C24H25N7O2/c1-2-19(32)17-5-3-16(4-6-17)14-31-15-27-21-23(30-9-11-33-12-10-30)28-22(29-24(21)31)18-7-8-20(25)26-13-18/h3-8,13,15H,2,9-12,14H2,1H3,(H2,25,26) |
| InChIKey | IPYLTCBQUMABIQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |