C27H28N6O3S — CID 59474308
(E)-3-[4-[[[2-(4-aminophenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methylamino]methyl]phenyl]-N-hydroxyprop-2-enamide (PubChem CID 59474308) has the molecular formula C27H28N6O3S and a molecular weight of 516.63 g/mol. Its IUPAC name is (E)-3-[4-[[[2-(4-aminophenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methylamino]methyl]phenyl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[4-[[[2-(4-aminophenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methylamino]methyl]phenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 59474308 |
| Molecular Formula | C27H28N6O3S |
| Molecular Weight | 516.63 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | (E)-3-[4-[[[2-(4-aminophenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methylamino]methyl]phenyl]-N-hydroxyprop-2-enamide |
| SMILES | Nc1ccc(-c2nc(N3CCOCC3)c3sc(CNCc4ccc(/C=C/C(=O)NO)cc4)cc3n2)cc1 |
| InChI | InChI=1S/C27H28N6O3S/c28-21-8-6-20(7-9-21)26-30-23-15-22(37-25(23)27(31-26)33-11-13-36-14-12-33)17-29-16-19-3-1-18(2-4-19)5-10-24(34)32-35/h1-10,15,29,35H,11-14,16-17,28H2,(H,32,34)/b10-5+ |
| InChIKey | HRWGTJPVPPHYIX-BJMVGYQFSA-N |
| XLogP | 3.59 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.63 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|