C27H28N6O3S — CID 130242036
N-[[2-(3-amino-2-methanimidoylphenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methyl]-2-(3-methoxyphenyl)acetamide (PubChem CID 130242036) has the molecular formula C27H28N6O3S and a molecular weight of 516.63 g/mol. Its IUPAC name is N-[[2-(3-amino-2-methanimidoylphenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methyl]-2-(3-methoxyphenyl)acetamide.
| Compound Name | N-[[2-(3-amino-2-methanimidoylphenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methyl]-2-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 130242036 |
| Molecular Formula | C27H28N6O3S |
| Molecular Weight | 516.63 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | N-[[2-(3-amino-2-methanimidoylphenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methyl]-2-(3-methoxyphenyl)acetamide |
| SMILES | [H]/N=C/c1c(N)cccc1-c1nc(N2CCOCC2)c2sc(CNC(=O)Cc3cccc(OC)c3)cc2n1 |
| InChI | InChI=1S/C27H28N6O3S/c1-35-18-5-2-4-17(12-18)13-24(34)30-16-19-14-23-25(37-19)27(33-8-10-36-11-9-33)32-26(31-23)20-6-3-7-22(29)21(20)15-28/h2-7,12,14-15,28H,8-11,13,16,29H2,1H3,(H,30,34)/b28-15+ |
| InChIKey | FMYBIOZQQCUOLH-RWPZCVJISA-N |
| XLogP | 3.64 |
| TPSA | 126.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.63 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|