C25H31N7O3S — CID 143572047
ethyl 4-[[2-(3-amino-2-methanimidoylphenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methyl]piperazine-1-carboxylate (PubChem CID 143572047) has the molecular formula C25H31N7O3S and a molecular weight of 509.64 g/mol. Its IUPAC name is ethyl 4-[[2-(3-amino-2-methanimidoylphenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[[2-(3-amino-2-methanimidoylphenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 143572047 |
| Molecular Formula | C25H31N7O3S |
| Molecular Weight | 509.64 g/mol |
| Exact Mass | 509.22 |
| IUPAC Name | ethyl 4-[[2-(3-amino-2-methanimidoylphenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methyl]piperazine-1-carboxylate |
| SMILES | [H]/N=C/c1c(N)cccc1-c1nc(N2CCOCC2)c2sc(CN3CCN(C(=O)OCC)CC3)cc2n1 |
| InChI | InChI=1S/C25H31N7O3S/c1-2-35-25(33)32-8-6-30(7-9-32)16-17-14-21-22(36-17)24(31-10-12-34-13-11-31)29-23(28-21)18-4-3-5-20(27)19(18)15-26/h3-5,14-15,26H,2,6-13,16,27H2,1H3/b26-15+ |
| InChIKey | NYNGEXVQGAQPBR-CVKSISIWSA-N |
| XLogP | 3.05 |
| TPSA | 120.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.64 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|