C26H34N8O3S2 — CID 143572141
2-methanimidoyl-3-[4-morpholin-4-yl-6-[(4-morpholin-4-ylsulfinylpiperazin-1-yl)methyl]thieno[3,2-d]pyrimidin-2-yl]aniline (PubChem CID 143572141) has the molecular formula C26H34N8O3S2 and a molecular weight of 570.75 g/mol. Its IUPAC name is 2-methanimidoyl-3-[4-morpholin-4-yl-6-[(4-morpholin-4-ylsulfinylpiperazin-1-yl)methyl]thieno[3,2-d]pyrimidin-2-yl]aniline.
| Compound Name | 2-methanimidoyl-3-[4-morpholin-4-yl-6-[(4-morpholin-4-ylsulfinylpiperazin-1-yl)methyl]thieno[3,2-d]pyrimidin-2-yl]aniline |
|---|---|
| PubChem CID | 143572141 |
| Molecular Formula | C26H34N8O3S2 |
| Molecular Weight | 570.75 g/mol |
| Exact Mass | 570.22 |
| IUPAC Name | 2-methanimidoyl-3-[4-morpholin-4-yl-6-[(4-morpholin-4-ylsulfinylpiperazin-1-yl)methyl]thieno[3,2-d]pyrimidin-2-yl]aniline |
| SMILES | [H]/N=C/c1c(N)cccc1-c1nc(N2CCOCC2)c2sc(CN3CCN(S(=O)N4CCOCC4)CC3)cc2n1 |
| InChI | InChI=1S/C26H34N8O3S2/c27-17-21-20(2-1-3-22(21)28)25-29-23-16-19(38-24(23)26(30-25)32-8-12-36-13-9-32)18-31-4-6-33(7-5-31)39(35)34-10-14-37-15-11-34/h1-3,16-17,27H,4-15,18,28H2/b27-17+ |
| InChIKey | UVSMHLDKFYEWTI-WPWMEQJKSA-N |
| XLogP | 1.80 |
| TPSA | 124.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.75 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|