C24H30N8O2S — CID 143572106
2-amino-1-[4-[[2-(3-amino-2-methanimidoylphenyl)-4-morpholin-4-ylthieno[2,3-d]pyrimidin-6-yl]methyl]piperazin-1-yl]ethanone (PubChem CID 143572106) has the molecular formula C24H30N8O2S and a molecular weight of 494.63 g/mol. Its IUPAC name is 2-amino-1-[4-[[2-(3-amino-2-methanimidoylphenyl)-4-morpholin-4-ylthieno[2,3-d]pyrimidin-6-yl]methyl]piperazin-1-yl]ethanone.
| Compound Name | 2-amino-1-[4-[[2-(3-amino-2-methanimidoylphenyl)-4-morpholin-4-ylthieno[2,3-d]pyrimidin-6-yl]methyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 143572106 |
| Molecular Formula | C24H30N8O2S |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | 2-amino-1-[4-[[2-(3-amino-2-methanimidoylphenyl)-4-morpholin-4-ylthieno[2,3-d]pyrimidin-6-yl]methyl]piperazin-1-yl]ethanone |
| SMILES | [H]/N=C/c1c(N)cccc1-c1nc(N2CCOCC2)c2cc(CN3CCN(C(=O)CN)CC3)sc2n1 |
| InChI | InChI=1S/C24H30N8O2S/c25-13-19-17(2-1-3-20(19)27)22-28-23(32-8-10-34-11-9-32)18-12-16(35-24(18)29-22)15-30-4-6-31(7-5-30)21(33)14-26/h1-3,12-13,25H,4-11,14-15,26-27H2/b25-13+ |
| InChIKey | JYXGECUFGFBRSK-DHRITJCHSA-N |
| XLogP | 1.38 |
| TPSA | 137.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|