C34H34N6O3S — CID 123646757
1-[4-[2-(3-amino-2-methanimidoylphenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]-3,6-dihydro-2H-pyridin-1-yl]-6-phenylhex-5-ene-1,4-dione (PubChem CID 123646757) has the molecular formula C34H34N6O3S and a molecular weight of 606.75 g/mol. Its IUPAC name is 1-[4-[2-(3-amino-2-methanimidoylphenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]-3,6-dihydro-2H-pyridin-1-yl]-6-phenylhex-5-ene-1,4-dione.
| Compound Name | 1-[4-[2-(3-amino-2-methanimidoylphenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]-3,6-dihydro-2H-pyridin-1-yl]-6-phenylhex-5-ene-1,4-dione |
|---|---|
| PubChem CID | 123646757 |
| Molecular Formula | C34H34N6O3S |
| Molecular Weight | 606.75 g/mol |
| Exact Mass | 606.24 |
| IUPAC Name | 1-[4-[2-(3-amino-2-methanimidoylphenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]-3,6-dihydro-2H-pyridin-1-yl]-6-phenylhex-5-ene-1,4-dione |
| SMILES | [H]/N=C/c1c(N)cccc1-c1nc(N2CCOCC2)c2sc(C3=CCN(C(=O)CCC(=O)C=Cc4ccccc4)CC3)cc2n1 |
| InChI | InChI=1S/C34H34N6O3S/c35-22-27-26(7-4-8-28(27)36)33-37-29-21-30(44-32(29)34(38-33)40-17-19-43-20-18-40)24-13-15-39(16-14-24)31(42)12-11-25(41)10-9-23-5-2-1-3-6-23/h1-10,13,21-22,35H,11-12,14-20,36H2/b10-9?,35-22+ |
| InChIKey | MXUGGAVGHIWZRM-APUBCPDOSA-N |
| XLogP | 5.45 |
| TPSA | 125.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.75 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|